C15H24N2O2 — CID 2859057
2-[3-(dimethylamino)propyl]-4,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 2859057) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl]-4,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[3-(dimethylamino)propyl]-4,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2859057 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-[3-(dimethylamino)propyl]-4,6-dimethyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=CC(C)C2C(=O)N(CCCN(C)C)C(=O)C2C1 |
| InChI | InChI=1S/C15H24N2O2/c1-10-8-11(2)13-12(9-10)14(18)17(15(13)19)7-5-6-16(3)4/h8,11-13H,5-7,9H2,1-4H3 |
| InChIKey | OLVIZFKZLFJCGX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|