C22H27ClN2O3S — CID 28590817
5-(azepan-1-ylsulfonyl)-2-chloro-N-(2-ethyl-6-methylphenyl)benzamide (PubChem CID 28590817) has the molecular formula C22H27ClN2O3S and a molecular weight of 434.99 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-chloro-N-(2-ethyl-6-methylphenyl)benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-(2-ethyl-6-methylphenyl)benzamide |
|---|---|
| PubChem CID | 28590817 |
| Molecular Formula | C22H27ClN2O3S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-chloro-N-(2-ethyl-6-methylphenyl)benzamide |
| SMILES | CCc1cccc(C)c1NC(=O)c1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C22H27ClN2O3S/c1-3-17-10-8-9-16(2)21(17)24-22(26)19-15-18(11-12-20(19)23)29(27,28)25-13-6-4-5-7-14-25/h8-12,15H,3-7,13-14H2,1-2H3,(H,24,26) |
| InChIKey | JQQLYYLWEVMWPN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |