C23H23N3O6S2 — CID 28591624
4-[ethyl-(4-methylsulfanylphenyl)sulfonylamino]-N-(2-methoxy-5-nitrophenyl)benzamide (PubChem CID 28591624) has the molecular formula C23H23N3O6S2 and a molecular weight of 501.59 g/mol. Its IUPAC name is 4-[ethyl-(4-methylsulfanylphenyl)sulfonylamino]-N-(2-methoxy-5-nitrophenyl)benzamide.
| Compound Name | 4-[ethyl-(4-methylsulfanylphenyl)sulfonylamino]-N-(2-methoxy-5-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 28591624 |
| Molecular Formula | C23H23N3O6S2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 4-[ethyl-(4-methylsulfanylphenyl)sulfonylamino]-N-(2-methoxy-5-nitrophenyl)benzamide |
| SMILES | CCN(c1ccc(C(=O)Nc2cc([N+](=O)[O-])ccc2OC)cc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C23H23N3O6S2/c1-4-25(34(30,31)20-12-10-19(33-3)11-13-20)17-7-5-16(6-8-17)23(27)24-21-15-18(26(28)29)9-14-22(21)32-2/h5-15H,4H2,1-3H3,(H,24,27) |
| InChIKey | QEOIBWZXPNOZHW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|