About 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine
5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine (PubChem CID 2859280) has the molecular formula C8H7BrN4
and a molecular weight of 239.08 g/mol. Its IUPAC name is 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine |
| PubChem CID | 2859280 |
| Molecular Formula | C8H7BrN4 |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2ccccc2Br)n1 |
| InChI | InChI=1S/C8H7BrN4/c9-6-4-2-1-3-5(6)7-11-8(10)13-12-7/h1-4H,(H3,10,11,12,13) |
| InChIKey | CXRHBUWCLZAXAC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine (CID 2859280) is 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine is Nc1n[nH]c(-c2ccccc2Br)n1.
What is the InChIKey of 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine?
The InChIKey is CXRHBUWCLZAXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN4/c9-6-4-2-1-3-5(6)7-11-8(10)13-12-7/h1-4H,(H3,10,11,12,13).
What are the key properties of 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine?
5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine has a molecular weight of 239.08 g/mol, XLogP of 1.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 2859280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).