About Bis(diethyldithiocarbamato-S,S')lead
Bis(diethyldithiocarbamato-S,S')lead (PubChem CID 28593) has the molecular formula C10H20N2PbS4
and a molecular weight of 504.00 g/mol. Its IUPAC name is bis(N,N-diethylcarbamodithioate);lead(2+).
Molecular Properties
| Compound Name | Bis(diethyldithiocarbamato-S,S')lead |
| PubChem CID | 28593 |
| Molecular Formula | C10H20N2PbS4 |
| Molecular Weight | 504.00 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | bis(N,N-diethylcarbamodithioate);lead(2+) |
| SMILES | CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Pb+2] |
| InChI | InChI=1S/2C5H11NS2.Pb/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | XTFSWQKNABTKAT-UHFFFAOYSA-L |
| XLogP | — |
| TPSA | 72.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | 73 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze Bis(diethyldithiocarbamato-S,S')lead with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bis(diethyldithiocarbamato-S,S')lead?
The IUPAC name of Bis(diethyldithiocarbamato-S,S')lead (CID 28593) is bis(N,N-diethylcarbamodithioate);lead(2+).
What is the SMILES notation for Bis(diethyldithiocarbamato-S,S')lead?
The canonical SMILES for Bis(diethyldithiocarbamato-S,S')lead is CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Pb+2].
What is the InChIKey of Bis(diethyldithiocarbamato-S,S')lead?
The InChIKey is XTFSWQKNABTKAT-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H11NS2.Pb/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2.
What are the key properties of Bis(diethyldithiocarbamato-S,S')lead?
Bis(diethyldithiocarbamato-S,S')lead has a molecular weight of 504.00 g/mol, XLogP of not available, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Bis(diethyldithiocarbamato-S,S')lead is sourced from PubChem (CID 28593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).