C11H17N3O3 — CID 2859665
1-(1-methyl-2,5-dioxopyrrolidin-3-yl)piperidine-4-carboxamide (PubChem CID 2859665) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-(1-methyl-2,5-dioxopyrrolidin-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-(1-methyl-2,5-dioxopyrrolidin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 2859665 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(1-methyl-2,5-dioxopyrrolidin-3-yl)piperidine-4-carboxamide |
| SMILES | CN1C(=O)CC(N2CCC(C(N)=O)CC2)C1=O |
| InChI | InChI=1S/C11H17N3O3/c1-13-9(15)6-8(11(13)17)14-4-2-7(3-5-14)10(12)16/h7-8H,2-6H2,1H3,(H2,12,16) |
| InChIKey | LTANHDXVPSDNFV-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|