About 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol
3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol (PubChem CID 2859779) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol.
Molecular Properties
| Compound Name | 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol |
| PubChem CID | 2859779 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol |
| SMILES | CN(C)CC(C)(C)C/N=C/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C16H23N3O/c1-16(2,11-19(3)4)10-17-9-13-12-7-5-6-8-14(12)18-15(13)20/h5-9,18,20H,10-11H2,1-4H3/b17-9+ |
| InChIKey | HRDRHJARSLHCBK-RQZCQDPDSA-N |
| XLogP | 2.88 |
| TPSA | 51.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol?
The IUPAC name of 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol (CID 2859779) is 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol.
What is the SMILES notation for 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol?
The canonical SMILES for 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol is CN(C)CC(C)(C)C/N=C/c1c(O)[nH]c2ccccc12.
What is the InChIKey of 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol?
The InChIKey is HRDRHJARSLHCBK-RQZCQDPDSA-N. The full InChI is InChI=1S/C16H23N3O/c1-16(2,11-19(3)4)10-17-9-13-12-7-5-6-8-14(12)18-15(13)20/h5-9,18,20H,10-11H2,1-4H3/b17-9+.
What are the key properties of 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol?
3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol has a molecular weight of 273.38 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(dimethylamino)-2,2-dimethylpropyl]iminomethyl]-1H-indol-2-ol is sourced from PubChem (CID 2859779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).