About 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol
3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol (PubChem CID 2859793) has the molecular formula C18H18N2O4
and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol.
Molecular Properties
| Compound Name | 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol |
| PubChem CID | 2859793 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol |
| SMILES | COc1cc(/N=C/c2c(O)[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N2O4/c1-22-15-8-11(9-16(23-2)17(15)24-3)19-10-13-12-6-4-5-7-14(12)20-18(13)21/h4-10,20-21H,1-3H3/b19-10+ |
| InChIKey | LTTOREADUZVGKO-VXLYETTFSA-N |
| XLogP | 3.65 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol?
The IUPAC name of 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol (CID 2859793) is 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol.
What is the SMILES notation for 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol?
The canonical SMILES for 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol is COc1cc(/N=C/c2c(O)[nH]c3ccccc23)cc(OC)c1OC.
What is the InChIKey of 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol?
The InChIKey is LTTOREADUZVGKO-VXLYETTFSA-N. The full InChI is InChI=1S/C18H18N2O4/c1-22-15-8-11(9-16(23-2)17(15)24-3)19-10-13-12-6-4-5-7-14(12)20-18(13)21/h4-10,20-21H,1-3H3/b19-10+.
What are the key properties of 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol?
3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol has a molecular weight of 326.35 g/mol, XLogP of 3.65, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4,5-trimethoxyphenyl)iminomethyl]-1H-indol-2-ol is sourced from PubChem (CID 2859793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).