About 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide
2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 2859821) has the molecular formula C9H13N5O4
and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
| PubChem CID | 2859821 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)NCC1CCCO1 |
| InChI | InChI=1S/C9H13N5O4/c15-8(10-4-7-2-1-3-18-7)5-13-6-11-9(12-13)14(16)17/h6-7H,1-5H2,(H,10,15) |
| InChIKey | LDTGMVGOKBJMIK-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
The IUPAC name of 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide (CID 2859821) is 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide.
What is the SMILES notation for 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
The canonical SMILES for 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide is O=C(Cn1cnc([N+](=O)[O-])n1)NCC1CCCO1.
What is the InChIKey of 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
The InChIKey is LDTGMVGOKBJMIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O4/c15-8(10-4-7-2-1-3-18-7)5-13-6-11-9(12-13)14(16)17/h6-7H,1-5H2,(H,10,15).
What are the key properties of 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide?
2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide has a molecular weight of 255.23 g/mol, XLogP of -0.52, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitro-1,2,4-triazol-1-yl)-N-(oxolan-2-ylmethyl)acetamide is sourced from PubChem (CID 2859821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).