C27H25NO7S3 — CID 2859967
dimethyl 2-[6-methoxy-1-(4-methoxybenzoyl)-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 2859967) has the molecular formula C27H25NO7S3 and a molecular weight of 571.70 g/mol. Its IUPAC name is dimethyl 2-[6-methoxy-1-(4-methoxybenzoyl)-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[6-methoxy-1-(4-methoxybenzoyl)-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 2859967 |
| Molecular Formula | C27H25NO7S3 |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | dimethyl 2-[6-methoxy-1-(4-methoxybenzoyl)-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2C(=S)C(C)(C)N(C(=O)c3ccc(OC)cc3)c3ccc(OC)cc32)S1 |
| InChI | InChI=1S/C27H25NO7S3/c1-27(2)22(36)19(26-37-20(24(30)34-5)21(38-26)25(31)35-6)17-13-16(33-4)11-12-18(17)28(27)23(29)14-7-9-15(32-3)10-8-14/h7-13H,1-6H3 |
| InChIKey | UMXKXHUASOSITL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|