About 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride
2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 2860025) has the molecular formula C14H20Cl2N2OS
and a molecular weight of 335.30 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride |
| PubChem CID | 2860025 |
| Molecular Formula | C14H20Cl2N2OS |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | CN(C)CCCN1C(=O)CSC1c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C14H19ClN2OS.ClH/c1-16(2)7-4-8-17-13(18)10-19-14(17)11-5-3-6-12(15)9-11;/h3,5-6,9,14H,4,7-8,10H2,1-2H3;1H |
| InChIKey | NTMDCIITEAOVHI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride?
The IUPAC name of 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride (CID 2860025) is 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride.
What is the SMILES notation for 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride?
The canonical SMILES for 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride is CN(C)CCCN1C(=O)CSC1c1cccc(Cl)c1.Cl.
What is the InChIKey of 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride?
The InChIKey is NTMDCIITEAOVHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN2OS.ClH/c1-16(2)7-4-8-17-13(18)10-19-14(17)11-5-3-6-12(15)9-11;/h3,5-6,9,14H,4,7-8,10H2,1-2H3;1H.
What are the key properties of 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride?
2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride has a molecular weight of 335.30 g/mol, XLogP of 3.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-3-[3-(dimethylamino)propyl]-1,3-thiazolidin-4-one;hydrochloride is sourced from PubChem (CID 2860025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).