About 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol
2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol (PubChem CID 2860190) has the molecular formula C14H12N2OS
and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol |
| PubChem CID | 2860190 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol |
| SMILES | Oc1ccccc1C1NN=C(c2ccccc2)S1 |
| InChI | InChI=1S/C14H12N2OS/c17-12-9-5-4-8-11(12)14-16-15-13(18-14)10-6-2-1-3-7-10/h1-9,14,16-17H |
| InChIKey | GNWIRYWGLDZKRK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol?
The IUPAC name of 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol (CID 2860190) is 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol.
What is the SMILES notation for 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol?
The canonical SMILES for 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol is Oc1ccccc1C1NN=C(c2ccccc2)S1.
What is the InChIKey of 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol?
The InChIKey is GNWIRYWGLDZKRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2OS/c17-12-9-5-4-8-11(12)14-16-15-13(18-14)10-6-2-1-3-7-10/h1-9,14,16-17H.
What are the key properties of 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol?
2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol has a molecular weight of 256.33 g/mol, XLogP of 3.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-phenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)phenol is sourced from PubChem (CID 2860190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).