C11H14N2O2S — CID 28602163
methyl 2-(2-carbamothioyl-N-methylanilino)acetate (PubChem CID 28602163) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is methyl 2-(2-carbamothioyl-N-methylanilino)acetate.
| Compound Name | methyl 2-(2-carbamothioyl-N-methylanilino)acetate |
|---|---|
| PubChem CID | 28602163 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methyl 2-(2-carbamothioyl-N-methylanilino)acetate |
| SMILES | COC(=O)CN(C)c1ccccc1C(N)=S |
| InChI | InChI=1S/C11H14N2O2S/c1-13(7-10(14)15-2)9-6-4-3-5-8(9)11(12)16/h3-6H,7H2,1-2H3,(H2,12,16) |
| InChIKey | OQSIUSCINUTKRT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|