C24H15Cl2NO5 — CID 28605123
4-[(2S)-2-(4-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 28605123) has the molecular formula C24H15Cl2NO5 and a molecular weight of 468.29 g/mol. Its IUPAC name is 4-[(2S)-2-(4-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[(2S)-2-(4-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 28605123 |
| Molecular Formula | C24H15Cl2NO5 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 4-[(2S)-2-(4-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | O=C1C(=O)N(c2ccc(C(=O)O)cc2)[C@@H](c2ccc(Cl)cc2)C1=C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15Cl2NO5/c25-16-7-1-13(2-8-16)20-19(21(28)14-3-9-17(26)10-4-14)22(29)23(30)27(20)18-11-5-15(6-12-18)24(31)32/h1-12,20,28H,(H,31,32)/t20-/m0/s1 |
| InChIKey | VUZSENBFSQZRHC-FQEVSTJZSA-N |
| XLogP | 5.32 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|