C5H8N2O2 — CID 28605219
(3S)-3-(aminomethyl)pyrrolidine-2,5-dione (PubChem CID 28605219) has the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(aminomethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 28605219 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | (3S)-3-(aminomethyl)pyrrolidine-2,5-dione |
| SMILES | NC[C@@H]1CC(=O)NC1=O |
| InChI | InChI=1S/C5H8N2O2/c6-2-3-1-4(8)7-5(3)9/h3H,1-2,6H2,(H,7,8,9)/t3-/m0/s1 |
| InChIKey | GLEJFOKLZHFGPI-VKHMYHEASA-N |
| XLogP | -1.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|