C14H17IN2O3S — CID 2860759
ethyl 2-(3-hydroxy-3,4-dihydro-2H-[1,3]thiazino[2,3-b]benzimidazol-5-ium-10-yl)acetate iodide (PubChem CID 2860759) has the molecular formula C14H17IN2O3S and a molecular weight of 420.27 g/mol. Its IUPAC name is ethyl 2-(3-hydroxy-3,4-dihydro-2H-[1,3]thiazino[2,3-b]benzimidazol-5-ium-10-yl)acetate iodide.
| Compound Name | ethyl 2-(3-hydroxy-3,4-dihydro-2H-[1,3]thiazino[2,3-b]benzimidazol-5-ium-10-yl)acetate iodide |
|---|---|
| PubChem CID | 2860759 |
| Molecular Formula | C14H17IN2O3S |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | ethyl 2-(3-hydroxy-3,4-dihydro-2H-[1,3]thiazino[2,3-b]benzimidazol-5-ium-10-yl)acetate iodide |
| SMILES | CCOC(=O)Cn1c2[n+](c3ccccc31)CC(O)CS2.[I-] |
| InChI | InChI=1S/C14H17N2O3S.HI/c1-2-19-13(18)8-16-12-6-4-3-5-11(12)15-7-10(17)9-20-14(15)16;/h3-6,10,17H,2,7-9H2,1H3;1H/q+1;/p-1 |
| InChIKey | SHEHLZPOTSINDW-UHFFFAOYSA-M |
| XLogP | -2.04 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|