About 1-phenylpyrazol-3-amine;hydrochloride
1-phenylpyrazol-3-amine;hydrochloride (PubChem CID 2860831) has the molecular formula C9H10ClN3
and a molecular weight of 195.65 g/mol. Its IUPAC name is 1-phenylpyrazol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-phenylpyrazol-3-amine;hydrochloride |
| PubChem CID | 2860831 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1-phenylpyrazol-3-amine;hydrochloride |
| SMILES | Cl.Nc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H9N3.ClH/c10-9-6-7-12(11-9)8-4-2-1-3-5-8;/h1-7H,(H2,10,11);1H |
| InChIKey | KYPFDNIHBWUVAL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylpyrazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpyrazol-3-amine;hydrochloride?
The IUPAC name of 1-phenylpyrazol-3-amine;hydrochloride (CID 2860831) is 1-phenylpyrazol-3-amine;hydrochloride.
What is the SMILES notation for 1-phenylpyrazol-3-amine;hydrochloride?
The canonical SMILES for 1-phenylpyrazol-3-amine;hydrochloride is Cl.Nc1ccn(-c2ccccc2)n1.
What is the InChIKey of 1-phenylpyrazol-3-amine;hydrochloride?
The InChIKey is KYPFDNIHBWUVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.ClH/c10-9-6-7-12(11-9)8-4-2-1-3-5-8;/h1-7H,(H2,10,11);1H.
What are the key properties of 1-phenylpyrazol-3-amine;hydrochloride?
1-phenylpyrazol-3-amine;hydrochloride has a molecular weight of 195.65 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyrazol-3-amine;hydrochloride is sourced from PubChem (CID 2860831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).