C8H16F3N — CID 28608773
(2R,3R)-3-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine (PubChem CID 28608773) has the molecular formula C8H16F3N and a molecular weight of 183.22 g/mol. Its IUPAC name is (2R,3R)-3-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine.
| Compound Name | (2R,3R)-3-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine |
|---|---|
| PubChem CID | 28608773 |
| Molecular Formula | C8H16F3N |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | (2R,3R)-3-methyl-N-(2,2,2-trifluoroethyl)pentan-2-amine |
| SMILES | CC[C@@H](C)[C@@H](C)NCC(F)(F)F |
| InChI | InChI=1S/C8H16F3N/c1-4-6(2)7(3)12-5-8(9,10)11/h6-7,12H,4-5H2,1-3H3/t6-,7-/m1/s1 |
| InChIKey | PQBGTTOBYWOKJH-RNFRBKRXSA-N |
| XLogP | 2.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |