C20H28N2O6S — CID 28610795
N-(3-ethoxypropyl)-6,7-dimethoxy-4-methyl-2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide (PubChem CID 28610795) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-6,7-dimethoxy-4-methyl-2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-6,7-dimethoxy-4-methyl-2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 28610795 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-(3-ethoxypropyl)-6,7-dimethoxy-4-methyl-2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazine-3-carboxamide |
| SMILES | C=CCN1c2cc(OC)c(OC)cc2C(C)=C(C(=O)NCCCOCC)S1(=O)=O |
| InChI | InChI=1S/C20H28N2O6S/c1-6-10-22-16-13-18(27-5)17(26-4)12-15(16)14(3)19(29(22,24)25)20(23)21-9-8-11-28-7-2/h6,12-13H,1,7-11H2,2-5H3,(H,21,23) |
| InChIKey | QGUCZIRIDVTWQL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|