C23H18BrN3O5 — CID 28611372
[4-[(4R)-2-amino-3-cyano-6-methyl-5-oxo-4H-pyrano[3,2-c]quinolin-4-yl]-2-bromo-6-methoxyphenyl] acetate (PubChem CID 28611372) has the molecular formula C23H18BrN3O5 and a molecular weight of 496.32 g/mol. Its IUPAC name is [4-[(4R)-2-amino-3-cyano-6-methyl-5-oxo-4H-pyrano[3,2-c]quinolin-4-yl]-2-bromo-6-methoxyphenyl] acetate.
| Compound Name | [4-[(4R)-2-amino-3-cyano-6-methyl-5-oxo-4H-pyrano[3,2-c]quinolin-4-yl]-2-bromo-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 28611372 |
| Molecular Formula | C23H18BrN3O5 |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | [4-[(4R)-2-amino-3-cyano-6-methyl-5-oxo-4H-pyrano[3,2-c]quinolin-4-yl]-2-bromo-6-methoxyphenyl] acetate |
| SMILES | COc1cc([C@@H]2C(C#N)=C(N)Oc3c2c(=O)n(C)c2ccccc32)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C23H18BrN3O5/c1-11(28)31-21-15(24)8-12(9-17(21)30-3)18-14(10-25)22(26)32-20-13-6-4-5-7-16(13)27(2)23(29)19(18)20/h4-9,18H,26H2,1-3H3/t18-/m1/s1 |
| InChIKey | YJEWNYANJIXDCV-GOSISDBHSA-N |
| XLogP | 3.45 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|