C22H26N6O — CID 2861253
2-N,4-N-bis(4-methylphenyl)-6-N-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 2861253) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-N,4-N-bis(4-methylphenyl)-6-N-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(4-methylphenyl)-6-N-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 2861253 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-N,4-N-bis(4-methylphenyl)-6-N-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(Nc2nc(NCC3CCCO3)nc(Nc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C22H26N6O/c1-15-5-9-17(10-6-15)24-21-26-20(23-14-19-4-3-13-29-19)27-22(28-21)25-18-11-7-16(2)8-12-18/h5-12,19H,3-4,13-14H2,1-2H3,(H3,23,24,25,26,27,28) |
| InChIKey | JOMIDJIZALJVIQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |