About N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide
N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide (PubChem CID 2861400) has the molecular formula C16H20N4O2
and a molecular weight of 300.36 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide.
Molecular Properties
| Compound Name | N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide |
| PubChem CID | 2861400 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide |
| SMILES | CC(NC(=O)C(=O)NCCCn1ccnc1)c1ccccc1 |
| InChI | InChI=1S/C16H20N4O2/c1-13(14-6-3-2-4-7-14)19-16(22)15(21)18-8-5-10-20-11-9-17-12-20/h2-4,6-7,9,11-13H,5,8,10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | GNDBNQLTECGTLP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide?
The IUPAC name of N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide (CID 2861400) is N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide.
What is the SMILES notation for N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide?
The canonical SMILES for N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide is CC(NC(=O)C(=O)NCCCn1ccnc1)c1ccccc1.
What is the InChIKey of N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide?
The InChIKey is GNDBNQLTECGTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O2/c1-13(14-6-3-2-4-7-14)19-16(22)15(21)18-8-5-10-20-11-9-17-12-20/h2-4,6-7,9,11-13H,5,8,10H2,1H3,(H,18,21)(H,19,22).
What are the key properties of N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide?
N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide has a molecular weight of 300.36 g/mol, XLogP of 1.27, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-imidazol-1-ylpropyl)-N'-(1-phenylethyl)oxamide is sourced from PubChem (CID 2861400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).