About 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide
9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide (PubChem CID 2862735) has the molecular formula C20H14N2O4S
and a molecular weight of 378.41 g/mol. Its IUPAC name is 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide.
Molecular Properties
| Compound Name | 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide |
| PubChem CID | 2862735 |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2S(=O)(=O)NNc1ccccc1 |
| InChI | InChI=1S/C20H14N2O4S/c23-19-14-9-4-5-10-15(14)20(24)18-16(19)11-6-12-17(18)27(25,26)22-21-13-7-2-1-3-8-13/h1-12,21-22H |
| InChIKey | FLMTWFBEVSRWLB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide?
The IUPAC name of 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide (CID 2862735) is 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide.
What is the SMILES notation for 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide?
The canonical SMILES for 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide is O=C1c2ccccc2C(=O)c2c1cccc2S(=O)(=O)NNc1ccccc1.
What is the InChIKey of 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide?
The InChIKey is FLMTWFBEVSRWLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O4S/c23-19-14-9-4-5-10-15(14)20(24)18-16(19)11-6-12-17(18)27(25,26)22-21-13-7-2-1-3-8-13/h1-12,21-22H.
What are the key properties of 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide?
9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide has a molecular weight of 378.41 g/mol, XLogP of 2.77, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dioxo-N'-phenylanthracene-1-sulfonohydrazide is sourced from PubChem (CID 2862735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).