C14H14N2O2S — CID 2863067
4-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-prop-2-enyl-1,3-thiazol-2-amine (PubChem CID 2863067) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-prop-2-enyl-1,3-thiazol-2-amine.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-prop-2-enyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2863067 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-prop-2-enyl-1,3-thiazol-2-amine |
| SMILES | C=CCNc1nc(C2COc3ccccc3O2)cs1 |
| InChI | InChI=1S/C14H14N2O2S/c1-2-7-15-14-16-10(9-19-14)13-8-17-11-5-3-4-6-12(11)18-13/h2-6,9,13H,1,7-8H2,(H,15,16) |
| InChIKey | RMUQRTIUAGPJRR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|