C18H17ClF3NO3 — CID 28631937
N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3,4-dimethoxyphenyl)propanamide (PubChem CID 28631937) has the molecular formula C18H17ClF3NO3 and a molecular weight of 387.79 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 28631937 |
| Molecular Formula | C18H17ClF3NO3 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)Nc2ccc(Cl)cc2C(F)(F)F)cc1OC |
| InChI | InChI=1S/C18H17ClF3NO3/c1-25-15-7-3-11(9-16(15)26-2)4-8-17(24)23-14-6-5-12(19)10-13(14)18(20,21)22/h3,5-7,9-10H,4,8H2,1-2H3,(H,23,24) |
| InChIKey | PDVZFVHYNYZBLR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |