C21H27NO2 — CID 28632091
(2S)-2-(2-ethylphenoxy)-N-[(1R)-1-(4-methylphenyl)propyl]propanamide (PubChem CID 28632091) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (2S)-2-(2-ethylphenoxy)-N-[(1R)-1-(4-methylphenyl)propyl]propanamide.
| Compound Name | (2S)-2-(2-ethylphenoxy)-N-[(1R)-1-(4-methylphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 28632091 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (2S)-2-(2-ethylphenoxy)-N-[(1R)-1-(4-methylphenyl)propyl]propanamide |
| SMILES | CCc1ccccc1O[C@@H](C)C(=O)N[C@H](CC)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H27NO2/c1-5-17-9-7-8-10-20(17)24-16(4)21(23)22-19(6-2)18-13-11-15(3)12-14-18/h7-14,16,19H,5-6H2,1-4H3,(H,22,23)/t16-,19+/m0/s1 |
| InChIKey | FMWKJSADZCCXAU-QFBILLFUSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |