C19H23IN2O4S — CID 28632113
N-[(1S)-1-(4-ethoxyphenyl)ethyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 28632113) has the molecular formula C19H23IN2O4S and a molecular weight of 502.37 g/mol. Its IUPAC name is N-[(1S)-1-(4-ethoxyphenyl)ethyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(1S)-1-(4-ethoxyphenyl)ethyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 28632113 |
| Molecular Formula | C19H23IN2O4S |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | N-[(1S)-1-(4-ethoxyphenyl)ethyl]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H23IN2O4S/c1-4-26-18-11-5-15(6-12-18)14(2)21-19(23)13-22(27(3,24)25)17-9-7-16(20)8-10-17/h5-12,14H,4,13H2,1-3H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | YSURZGVUWGPJOH-AWEZNQCLSA-N |
| XLogP | 3.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|