C22H25Br2NO4 — CID 2863251
propan-2-yl 4-(3,5-dibromo-2-hydroxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 2863251) has the molecular formula C22H25Br2NO4 and a molecular weight of 527.25 g/mol. Its IUPAC name is propan-2-yl 4-(3,5-dibromo-2-hydroxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | propan-2-yl 4-(3,5-dibromo-2-hydroxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2863251 |
| Molecular Formula | C22H25Br2NO4 |
| Molecular Weight | 527.25 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | propan-2-yl 4-(3,5-dibromo-2-hydroxyphenyl)-2,7,7-trimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2cc(Br)cc(Br)c2O)C2=C(CC(C)(C)CC2=O)N1 |
| InChI | InChI=1S/C22H25Br2NO4/c1-10(2)29-21(28)17-11(3)25-15-8-22(4,5)9-16(26)19(15)18(17)13-6-12(23)7-14(24)20(13)27/h6-7,10,18,25,27H,8-9H2,1-5H3 |
| InChIKey | IRAWZXNAJKVOTF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.25 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |