C23H22N2O4S2 — CID 28633920
4-methoxy-3-(2-oxopyrrolidin-1-yl)-N-(2-phenylsulfanylphenyl)benzenesulfonamide (PubChem CID 28633920) has the molecular formula C23H22N2O4S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 4-methoxy-3-(2-oxopyrrolidin-1-yl)-N-(2-phenylsulfanylphenyl)benzenesulfonamide.
| Compound Name | 4-methoxy-3-(2-oxopyrrolidin-1-yl)-N-(2-phenylsulfanylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 28633920 |
| Molecular Formula | C23H22N2O4S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 4-methoxy-3-(2-oxopyrrolidin-1-yl)-N-(2-phenylsulfanylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2Sc2ccccc2)cc1N1CCCC1=O |
| InChI | InChI=1S/C23H22N2O4S2/c1-29-21-14-13-18(16-20(21)25-15-7-12-23(25)26)31(27,28)24-19-10-5-6-11-22(19)30-17-8-3-2-4-9-17/h2-6,8-11,13-14,16,24H,7,12,15H2,1H3 |
| InChIKey | KKONRVZEHBYCQO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |