C22H23NO3 — CID 28633959
(2R)-N-[(1S)-1-(4-methoxyphenyl)ethyl]-2-naphthalen-1-yloxypropanamide (PubChem CID 28633959) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (2R)-N-[(1S)-1-(4-methoxyphenyl)ethyl]-2-naphthalen-1-yloxypropanamide.
| Compound Name | (2R)-N-[(1S)-1-(4-methoxyphenyl)ethyl]-2-naphthalen-1-yloxypropanamide |
|---|---|
| PubChem CID | 28633959 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (2R)-N-[(1S)-1-(4-methoxyphenyl)ethyl]-2-naphthalen-1-yloxypropanamide |
| SMILES | COc1ccc([C@H](C)NC(=O)[C@@H](C)Oc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-15(17-11-13-19(25-3)14-12-17)23-22(24)16(2)26-21-10-6-8-18-7-4-5-9-20(18)21/h4-16H,1-3H3,(H,23,24)/t15-,16+/m0/s1 |
| InChIKey | HZWYYDVLVMUZCY-JKSUJKDBSA-N |
| XLogP | 4.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |