C23H37N3O — CID 28634783
2-[(2S)-4-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-1-propan-2-ylpiperazin-2-yl]ethanol (PubChem CID 28634783) has the molecular formula C23H37N3O and a molecular weight of 371.57 g/mol. Its IUPAC name is 2-[(2S)-4-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-1-propan-2-ylpiperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-1-propan-2-ylpiperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 28634783 |
| Molecular Formula | C23H37N3O |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 2-[(2S)-4-[1-(2,3-dihydro-1H-inden-5-yl)piperidin-4-yl]-1-propan-2-ylpiperazin-2-yl]ethanol |
| SMILES | CC(C)N1CCN(C2CCN(c3ccc4c(c3)CCC4)CC2)C[C@@H]1CCO |
| InChI | InChI=1S/C23H37N3O/c1-18(2)26-14-13-25(17-23(26)10-15-27)21-8-11-24(12-9-21)22-7-6-19-4-3-5-20(19)16-22/h6-7,16,18,21,23,27H,3-5,8-15,17H2,1-2H3/t23-/m0/s1 |
| InChIKey | CDMMRHXWIHNPHL-QHCPKHFHSA-N |
| XLogP | 2.92 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|