C25H28N2O4S — CID 28635265
2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]-N-[(1S)-1-phenylpropyl]acetamide (PubChem CID 28635265) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]-N-[(1S)-1-phenylpropyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]-N-[(1S)-1-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 28635265 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-methoxy-5-methylanilino]-N-[(1S)-1-phenylpropyl]acetamide |
| SMILES | CC[C@H](NC(=O)CN(c1cc(C)ccc1OC)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O4S/c1-4-22(20-11-7-5-8-12-20)26-25(28)18-27(23-17-19(2)15-16-24(23)31-3)32(29,30)21-13-9-6-10-14-21/h5-17,22H,4,18H2,1-3H3,(H,26,28)/t22-/m0/s1 |
| InChIKey | GORAMRIGHSJYRF-QFIPXVFZSA-N |
| XLogP | 4.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |