C17H19N3O5S — CID 28635564
2-[(3-nitrophenyl)methylsulfonylamino]-N-propylbenzamide (PubChem CID 28635564) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)methylsulfonylamino]-N-propylbenzamide.
| Compound Name | 2-[(3-nitrophenyl)methylsulfonylamino]-N-propylbenzamide |
|---|---|
| PubChem CID | 28635564 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[(3-nitrophenyl)methylsulfonylamino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccccc1NS(=O)(=O)Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19N3O5S/c1-2-10-18-17(21)15-8-3-4-9-16(15)19-26(24,25)12-13-6-5-7-14(11-13)20(22)23/h3-9,11,19H,2,10,12H2,1H3,(H,18,21) |
| InChIKey | UXEUBVMWTQLLGH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|