C23H25NO2 — CID 28636082
(2S)-2-naphthalen-2-yloxy-N-[(1S)-1-phenylpropyl]butanamide (PubChem CID 28636082) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2S)-2-naphthalen-2-yloxy-N-[(1S)-1-phenylpropyl]butanamide.
| Compound Name | (2S)-2-naphthalen-2-yloxy-N-[(1S)-1-phenylpropyl]butanamide |
|---|---|
| PubChem CID | 28636082 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (2S)-2-naphthalen-2-yloxy-N-[(1S)-1-phenylpropyl]butanamide |
| SMILES | CC[C@H](Oc1ccc2ccccc2c1)C(=O)N[C@@H](CC)c1ccccc1 |
| InChI | InChI=1S/C23H25NO2/c1-3-21(18-11-6-5-7-12-18)24-23(25)22(4-2)26-20-15-14-17-10-8-9-13-19(17)16-20/h5-16,21-22H,3-4H2,1-2H3,(H,24,25)/t21-,22-/m0/s1 |
| InChIKey | MWBNUPRZYNIJJJ-VXKWHMMOSA-N |
| XLogP | 5.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |