About dimethylazanium;2,3,5-triiodobenzoate
dimethylazanium;2,3,5-triiodobenzoate (PubChem CID 28637) has the molecular formula C9H10I3NO2
and a molecular weight of 544.90 g/mol. Its IUPAC name is dimethylazanium;2,3,5-triiodobenzoate.
Molecular Properties
| Compound Name | dimethylazanium;2,3,5-triiodobenzoate |
| PubChem CID | 28637 |
| Molecular Formula | C9H10I3NO2 |
| Molecular Weight | 544.90 g/mol |
| Exact Mass | 544.78 |
| IUPAC Name | dimethylazanium;2,3,5-triiodobenzoate |
| SMILES | C[NH2+]C.O=C([O-])c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C7H3I3O2.C2H7N/c8-3-1-4(7(11)12)6(10)5(9)2-3;1-3-2/h1-2H,(H,11,12);3H,1-2H3 |
| InChIKey | ZHPOHJJDIBVQHS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 544.90 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dimethylazanium;2,3,5-triiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanium;2,3,5-triiodobenzoate?
The IUPAC name of dimethylazanium;2,3,5-triiodobenzoate (CID 28637) is dimethylazanium;2,3,5-triiodobenzoate.
What is the SMILES notation for dimethylazanium;2,3,5-triiodobenzoate?
The canonical SMILES for dimethylazanium;2,3,5-triiodobenzoate is C[NH2+]C.O=C([O-])c1cc(I)cc(I)c1I.
What is the InChIKey of dimethylazanium;2,3,5-triiodobenzoate?
The InChIKey is ZHPOHJJDIBVQHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3I3O2.C2H7N/c8-3-1-4(7(11)12)6(10)5(9)2-3;1-3-2/h1-2H,(H,11,12);3H,1-2H3.
What are the key properties of dimethylazanium;2,3,5-triiodobenzoate?
dimethylazanium;2,3,5-triiodobenzoate has a molecular weight of 544.90 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanium;2,3,5-triiodobenzoate is sourced from PubChem (CID 28637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).