C19H29NO3 — CID 28637408
(3R,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-3-(morpholin-4-ylmethyl)-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one (PubChem CID 28637408) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (3R,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-3-(morpholin-4-ylmethyl)-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | (3R,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-3-(morpholin-4-ylmethyl)-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 28637408 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (3R,3aR,4aS,8aR,9aR)-8a-methyl-5-methylidene-3-(morpholin-4-ylmethyl)-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)[C@@H](CN4CCOCC4)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C19H29NO3/c1-13-4-3-5-19(2)11-17-14(10-16(13)19)15(18(21)23-17)12-20-6-8-22-9-7-20/h14-17H,1,3-12H2,2H3/t14-,15+,16+,17-,19-/m1/s1 |
| InChIKey | YEGTXKOAAYOPAP-DIKXUDHVSA-N |
| XLogP | 2.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|