C16H15BrN2O5 — CID 28638196
methyl 3-[2-[2-(1-bromonaphthalen-2-yl)oxyacetyl]hydrazinyl]-3-oxopropanoate (PubChem CID 28638196) has the molecular formula C16H15BrN2O5 and a molecular weight of 395.21 g/mol. Its IUPAC name is methyl 3-[2-[2-(1-bromonaphthalen-2-yl)oxyacetyl]hydrazinyl]-3-oxopropanoate.
| Compound Name | methyl 3-[2-[2-(1-bromonaphthalen-2-yl)oxyacetyl]hydrazinyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 28638196 |
| Molecular Formula | C16H15BrN2O5 |
| Molecular Weight | 395.21 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | methyl 3-[2-[2-(1-bromonaphthalen-2-yl)oxyacetyl]hydrazinyl]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)NNC(=O)COc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C16H15BrN2O5/c1-23-15(22)8-13(20)18-19-14(21)9-24-12-7-6-10-4-2-3-5-11(10)16(12)17/h2-7H,8-9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | KVEFVVGILRBSBF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|