About 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione
5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione (PubChem CID 2863954) has the molecular formula C10H10N2O3S
and a molecular weight of 238.27 g/mol. Its IUPAC name is 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione |
| PubChem CID | 2863954 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(NC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C10H10N2O3S/c1-15-7-4-2-6(3-5-7)11-9-8(13)12-10(14)16-9/h2-5,9,11H,1H3,(H,12,13,14) |
| InChIKey | HWTYNNHEBQBFOE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione?
The IUPAC name of 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione (CID 2863954) is 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione.
What is the SMILES notation for 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione?
The canonical SMILES for 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione is COc1ccc(NC2SC(=O)NC2=O)cc1.
What is the InChIKey of 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione?
The InChIKey is HWTYNNHEBQBFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3S/c1-15-7-4-2-6(3-5-7)11-9-8(13)12-10(14)16-9/h2-5,9,11H,1H3,(H,12,13,14).
What are the key properties of 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione?
5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione has a molecular weight of 238.27 g/mol, XLogP of 1.42, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyanilino)-1,3-thiazolidine-2,4-dione is sourced from PubChem (CID 2863954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).