C16H16N2O7 — CID 2863955
ethyl 6-methyl-4-(6-nitro-1,3-benzodioxol-5-yl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate (PubChem CID 2863955) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is ethyl 6-methyl-4-(6-nitro-1,3-benzodioxol-5-yl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate.
| Compound Name | ethyl 6-methyl-4-(6-nitro-1,3-benzodioxol-5-yl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 2863955 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | ethyl 6-methyl-4-(6-nitro-1,3-benzodioxol-5-yl)-2-oxo-3,4-dihydro-1H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)CC1c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C16H16N2O7/c1-3-23-16(20)15-8(2)17-14(19)5-10(15)9-4-12-13(25-7-24-12)6-11(9)18(21)22/h4,6,10H,3,5,7H2,1-2H3,(H,17,19) |
| InChIKey | ONSVDTZWFKUWJX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|