C28H29N5O2 — CID 28640559
N-[3-[4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]phenoxy]propyl]pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 28640559) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[3-[4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]phenoxy]propyl]pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[3-[4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]phenoxy]propyl]pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 28640559 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | N-[3-[4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]phenoxy]propyl]pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(NCCCOc1ccc(CN2CC=C(c3ccccc3)CC2)cc1)c1cc2ncccn2n1 |
| InChI | InChI=1S/C28H29N5O2/c34-28(26-20-27-29-14-4-16-33(27)31-26)30-15-5-19-35-25-10-8-22(9-11-25)21-32-17-12-24(13-18-32)23-6-2-1-3-7-23/h1-4,6-12,14,16,20H,5,13,15,17-19,21H2,(H,30,34) |
| InChIKey | WQXWLNUIFOPOLF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|