About 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline
2-ethoxy-5-(1,2,4-triazol-4-yl)aniline (PubChem CID 28643059) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline.
Molecular Properties
| Compound Name | 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline |
| PubChem CID | 28643059 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline |
| SMILES | CCOc1ccc(-n2cnnc2)cc1N |
| InChI | InChI=1S/C10H12N4O/c1-2-15-10-4-3-8(5-9(10)11)14-6-12-13-7-14/h3-7H,2,11H2,1H3 |
| InChIKey | RVYNVXUKSPKMNR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline?
The IUPAC name of 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline (CID 28643059) is 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline.
What is the SMILES notation for 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline?
The canonical SMILES for 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline is CCOc1ccc(-n2cnnc2)cc1N.
What is the InChIKey of 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline?
The InChIKey is RVYNVXUKSPKMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-2-15-10-4-3-8(5-9(10)11)14-6-12-13-7-14/h3-7H,2,11H2,1H3.
What are the key properties of 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline?
2-ethoxy-5-(1,2,4-triazol-4-yl)aniline has a molecular weight of 204.23 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-5-(1,2,4-triazol-4-yl)aniline is sourced from PubChem (CID 28643059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).