About 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol
2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol (PubChem CID 28643079) has the molecular formula C8H5Br2N3O
and a molecular weight of 318.96 g/mol. Its IUPAC name is 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol.
Molecular Properties
| Compound Name | 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol |
| PubChem CID | 28643079 |
| Molecular Formula | C8H5Br2N3O |
| Molecular Weight | 318.96 g/mol |
| Exact Mass | 316.88 |
| IUPAC Name | 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol |
| SMILES | Oc1c(Br)cc(Br)cc1-n1cnnc1 |
| InChI | InChI=1S/C8H5Br2N3O/c9-5-1-6(10)8(14)7(2-5)13-3-11-12-4-13/h1-4,14H |
| InChIKey | BZPIMFOUDFEUEM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.96 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol?
The IUPAC name of 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol (CID 28643079) is 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol.
What is the SMILES notation for 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol?
The canonical SMILES for 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol is Oc1c(Br)cc(Br)cc1-n1cnnc1.
What is the InChIKey of 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol?
The InChIKey is BZPIMFOUDFEUEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Br2N3O/c9-5-1-6(10)8(14)7(2-5)13-3-11-12-4-13/h1-4,14H.
What are the key properties of 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol?
2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol has a molecular weight of 318.96 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-6-(1,2,4-triazol-4-yl)phenol is sourced from PubChem (CID 28643079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).