About 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol
3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol (PubChem CID 2864582) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol.
Molecular Properties
| Compound Name | 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol |
| PubChem CID | 2864582 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol |
| SMILES | COCc1cc(C(C)(C)C)c(O)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C16H26O3/c1-15(2,3)11-8-10(9-19-7)12(16(4,5)6)14(18)13(11)17/h8,17-18H,9H2,1-7H3 |
| InChIKey | TYHVUEJVFMFXBK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol?
The IUPAC name of 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol (CID 2864582) is 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol.
What is the SMILES notation for 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol?
The canonical SMILES for 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol is COCc1cc(C(C)(C)C)c(O)c(O)c1C(C)(C)C.
What is the InChIKey of 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol?
The InChIKey is TYHVUEJVFMFXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O3/c1-15(2,3)11-8-10(9-19-7)12(16(4,5)6)14(18)13(11)17/h8,17-18H,9H2,1-7H3.
What are the key properties of 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol?
3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol has a molecular weight of 266.38 g/mol, XLogP of 3.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-ditert-butyl-4-(methoxymethyl)benzene-1,2-diol is sourced from PubChem (CID 2864582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).