C16H22ClNO2 — CID 28646531
N-[2-(4-chlorophenyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 28646531) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 28646531 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | Clc1ccc(CCNC2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C16H22ClNO2/c17-14-3-1-13(2-4-14)7-10-18-15-5-8-16(9-6-15)19-11-12-20-16/h1-4,15,18H,5-12H2 |
| InChIKey | LXQUHWODVJGUJV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |