About 2,3-diphenyloxirane
2,3-diphenyloxirane (PubChem CID 28649) has the molecular formula C14H12O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,3-diphenyloxirane.
Molecular Properties
| Compound Name | 2,3-diphenyloxirane |
| PubChem CID | 28649 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 2,3-diphenyloxirane |
| SMILES | c1ccc(C2OC2c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | ARCJQKUWGAZPFX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diphenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenyloxirane?
The IUPAC name of 2,3-diphenyloxirane (CID 28649) is 2,3-diphenyloxirane.
What is the SMILES notation for 2,3-diphenyloxirane?
The canonical SMILES for 2,3-diphenyloxirane is c1ccc(C2OC2c2ccccc2)cc1.
What is the InChIKey of 2,3-diphenyloxirane?
The InChIKey is ARCJQKUWGAZPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10,13-14H.
What are the key properties of 2,3-diphenyloxirane?
2,3-diphenyloxirane has a molecular weight of 196.25 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenyloxirane is sourced from PubChem (CID 28649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).