C15H14ClF2N — CID 28649455
(1S)-1-(3-chlorophenyl)-N-[(2,4-difluorophenyl)methyl]ethanamine (PubChem CID 28649455) has the molecular formula C15H14ClF2N and a molecular weight of 281.73 g/mol. Its IUPAC name is (1S)-1-(3-chlorophenyl)-N-[(2,4-difluorophenyl)methyl]ethanamine.
| Compound Name | (1S)-1-(3-chlorophenyl)-N-[(2,4-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 28649455 |
| Molecular Formula | C15H14ClF2N |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (1S)-1-(3-chlorophenyl)-N-[(2,4-difluorophenyl)methyl]ethanamine |
| SMILES | C[C@H](NCc1ccc(F)cc1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H14ClF2N/c1-10(11-3-2-4-13(16)7-11)19-9-12-5-6-14(17)8-15(12)18/h2-8,10,19H,9H2,1H3/t10-/m0/s1 |
| InChIKey | JRNWBYPSJCZDNG-JTQLQIEISA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |