C16H17NO2 — CID 2864997
2-benzyl-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 2864997) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-benzyl-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-benzyl-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2864997 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-benzyl-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=CCC2C(=O)N(Cc3ccccc3)C(=O)C2C1 |
| InChI | InChI=1S/C16H17NO2/c1-11-7-8-13-14(9-11)16(19)17(15(13)18)10-12-5-3-2-4-6-12/h2-7,13-14H,8-10H2,1H3 |
| InChIKey | UELKDFIWNLGGTL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|