C13H14N4O2 — CID 28651694
6-[(1-methylpyrazol-4-yl)methylamino]-4H-1,4-benzoxazin-3-one (PubChem CID 28651694) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 6-[(1-methylpyrazol-4-yl)methylamino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(1-methylpyrazol-4-yl)methylamino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28651694 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 6-[(1-methylpyrazol-4-yl)methylamino]-4H-1,4-benzoxazin-3-one |
| SMILES | Cn1cc(CNc2ccc3c(c2)NC(=O)CO3)cn1 |
| InChI | InChI=1S/C13H14N4O2/c1-17-7-9(6-15-17)5-14-10-2-3-12-11(4-10)16-13(18)8-19-12/h2-4,6-7,14H,5,8H2,1H3,(H,16,18) |
| InChIKey | RDXBGUVKFOXVNL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|