C17H18N2 — CID 28652871
4-[[[(1R)-1-(2-methylphenyl)ethyl]amino]methyl]benzonitrile (PubChem CID 28652871) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-[[[(1R)-1-(2-methylphenyl)ethyl]amino]methyl]benzonitrile.
| Compound Name | 4-[[[(1R)-1-(2-methylphenyl)ethyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 28652871 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-[[[(1R)-1-(2-methylphenyl)ethyl]amino]methyl]benzonitrile |
| SMILES | Cc1ccccc1[C@@H](C)NCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H18N2/c1-13-5-3-4-6-17(13)14(2)19-12-16-9-7-15(11-18)8-10-16/h3-10,14,19H,12H2,1-2H3/t14-/m1/s1 |
| InChIKey | MRHLVHRUJCJGOQ-CQSZACIVSA-N |
| XLogP | 3.72 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |