C22H18N2O4 — CID 2865303
N-[4-(10,12,14-trioxo-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-11-yl)phenyl]acetamide (PubChem CID 2865303) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[4-(10,12,14-trioxo-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-11-yl)phenyl]acetamide.
| Compound Name | N-[4-(10,12,14-trioxo-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-11-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 2865303 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[4-(10,12,14-trioxo-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-11-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C3C4CC(=O)C(c5ccccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C22H18N2O4/c1-11(25)23-12-6-8-13(9-7-12)24-21(27)19-16-10-17(26)18(20(19)22(24)28)15-5-3-2-4-14(15)16/h2-9,16,18-20H,10H2,1H3,(H,23,25) |
| InChIKey | XZESUBFBZKJUNK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|